C25H27N5O5 — CID 178154851
3-[3-[[3-(3-cyclohexylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 178154851) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is 3-[3-[[3-(3-cyclohexylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[[3-(3-cyclohexylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178154851 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-[3-[[3-(3-cyclohexylphenyl)-1,2,4-oxadiazol-5-yl]methyl-methylamino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | CN(Cc1nc(-c2cccc(C3CCCCC3)c2)no1)C1=CC(=O)N(C2CCC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C25H27N5O5/c1-29(19-13-22(32)30(25(19)34)18-10-11-20(31)26-24(18)33)14-21-27-23(28-35-21)17-9-5-8-16(12-17)15-6-3-2-4-7-15/h5,8-9,12-13,15,18H,2-4,6-7,10-11,14H2,1H3,(H,26,31,33) |
| InChIKey | XLEKYOKAHVPOMS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|