C19H17N5O4S — CID 178154935
3-[3-[methyl-[(5-phenyl-1,2,4-thiadiazol-3-yl)methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 178154935) has the molecular formula C19H17N5O4S and a molecular weight of 411.44 g/mol. Its IUPAC name is 3-[3-[methyl-[(5-phenyl-1,2,4-thiadiazol-3-yl)methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[methyl-[(5-phenyl-1,2,4-thiadiazol-3-yl)methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178154935 |
| Molecular Formula | C19H17N5O4S |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 3-[3-[methyl-[(5-phenyl-1,2,4-thiadiazol-3-yl)methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | CN(Cc1nsc(-c2ccccc2)n1)C1=CC(=O)N(C2CCC(=O)NC2=O)C1=O |
| InChI | InChI=1S/C19H17N5O4S/c1-23(10-14-20-18(29-22-14)11-5-3-2-4-6-11)13-9-16(26)24(19(13)28)12-7-8-15(25)21-17(12)27/h2-6,9,12H,7-8,10H2,1H3,(H,21,25,27) |
| InChIKey | BWWBDXDWUBWCLM-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|