C21H20N4O5 — CID 178154900
3-[3-[methyl-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione (PubChem CID 178154900) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is 3-[3-[methyl-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-[methyl-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178154900 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[3-[methyl-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]amino]-2,5-dioxopyrrol-1-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(-c2coc(CN(C)C3=CC(=O)N(C4CCC(=O)NC4=O)C3=O)n2)cc1 |
| InChI | InChI=1S/C21H20N4O5/c1-12-3-5-13(6-4-12)14-11-30-18(22-14)10-24(2)16-9-19(27)25(21(16)29)15-7-8-17(26)23-20(15)28/h3-6,9,11,15H,7-8,10H2,1-2H3,(H,23,26,28) |
| InChIKey | HQIDERYEUYEJNY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|