C18H13N5O6 — CID 178155053
3-[5-[[3-(1,3-oxazol-5-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione (PubChem CID 178155053) has the molecular formula C18H13N5O6 and a molecular weight of 395.33 g/mol. Its IUPAC name is 3-[5-[[3-(1,3-oxazol-5-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[3-(1,3-oxazol-5-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178155053 |
| Molecular Formula | C18H13N5O6 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 3-[5-[[3-(1,3-oxazol-5-yl)-1,2,4-oxadiazol-5-yl]methyl]-2-oxo-1,3-benzoxazol-3-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(n2c(=O)oc3ccc(Cc4nc(-c5cnco5)no4)cc32)C(=O)N1 |
| InChI | InChI=1S/C18H13N5O6/c24-14-4-2-10(17(25)20-14)23-11-5-9(1-3-12(11)28-18(23)26)6-15-21-16(22-29-15)13-7-19-8-27-13/h1,3,5,7-8,10H,2,4,6H2,(H,20,24,25) |
| InChIKey | DQRCCPLXNOMEQH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|