C27H22FN5O4S2 — CID 178101043
[3-[5,7-dioxo-1-[[3-(3-phenylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite (PubChem CID 178101043) has the molecular formula C27H22FN5O4S2 and a molecular weight of 563.64 g/mol. Its IUPAC name is [3-[5,7-dioxo-1-[[3-(3-phenylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite.
| Compound Name | [3-[5,7-dioxo-1-[[3-(3-phenylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite |
|---|---|
| PubChem CID | 178101043 |
| Molecular Formula | C27H22FN5O4S2 |
| Molecular Weight | 563.64 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | [3-[5,7-dioxo-1-[[3-(3-phenylphenyl)-1,2,4-thiadiazol-5-yl]methyl]-3,4-dihydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-2,6-dioxopiperidin-1-yl] thiohypofluorite |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4cccc(-c5ccccc5)c4)ns2)CCC3)C(=O)N1SF |
| InChI | InChI=1S/C27H22FN5O4S2/c28-39-33-22(34)12-11-20(26(33)36)32-25(35)19-10-5-13-31(23(19)27(32)37)15-21-29-24(30-38-21)18-9-4-8-17(14-18)16-6-2-1-3-7-16/h1-4,6-9,14,20H,5,10-13,15H2 |
| InChIKey | FAZLPEULIDGIIV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|