C27H20F3N5O5 — CID 178100937
1-[[3-[3-(3,5-difluorophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 178100937) has the molecular formula C27H20F3N5O5 and a molecular weight of 551.48 g/mol. Its IUPAC name is 1-[[3-[3-(3,5-difluorophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 1-[[3-[3-(3,5-difluorophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 178100937 |
| Molecular Formula | C27H20F3N5O5 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 1-[[3-[3-(3,5-difluorophenyl)-2-fluorophenyl]-1,2,4-oxadiazol-5-yl]methyl]-6-(2,6-dioxopiperidin-3-yl)-3,4-dihydro-2H-pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1CCC(N2C(=O)C3=C(C2=O)N(Cc2nc(-c4cccc(-c5cc(F)cc(F)c5)c4F)no2)CCC3)C(=O)N1 |
| InChI | InChI=1S/C27H20F3N5O5/c28-14-9-13(10-15(29)11-14)16-3-1-4-17(22(16)30)24-32-21(40-33-24)12-34-8-2-5-18-23(34)27(39)35(26(18)38)19-6-7-20(36)31-25(19)37/h1,3-4,9-11,19H,2,5-8,12H2,(H,31,36,37) |
| InChIKey | KZATYHNKTCRFEO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|