C21H19N5O4 — CID 134357274
3-formyl-N,N-dimethyl-4-oxo-1-[2-oxo-2-[(5-pyridin-3-yl-2-pyridinyl)amino]ethyl]pyridine-2-carboxamide (PubChem CID 134357274) has the molecular formula C21H19N5O4 and a molecular weight of 405.41 g/mol. Its IUPAC name is 3-formyl-N,N-dimethyl-4-oxo-1-[2-oxo-2-[(5-pyridin-3-yl-2-pyridinyl)amino]ethyl]pyridine-2-carboxamide.
| Compound Name | 3-formyl-N,N-dimethyl-4-oxo-1-[2-oxo-2-[(5-pyridin-3-yl-2-pyridinyl)amino]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 134357274 |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-formyl-N,N-dimethyl-4-oxo-1-[2-oxo-2-[(5-pyridin-3-yl-2-pyridinyl)amino]ethyl]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1c(C=O)c(=O)ccn1CC(=O)Nc1ccc(-c2cccnc2)cn1 |
| InChI | InChI=1S/C21H19N5O4/c1-25(2)21(30)20-16(13-27)17(28)7-9-26(20)12-19(29)24-18-6-5-15(11-23-18)14-4-3-8-22-10-14/h3-11,13H,12H2,1-2H3,(H,23,24,29) |
| InChIKey | IXYGGLCYJOPWOF-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|