C9H17NO — CID 13435867
2,4-di(propan-2-yl)-4,5-dihydro-1,3-oxazole (PubChem CID 13435867) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 2,4-di(propan-2-yl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 2,4-di(propan-2-yl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 13435867 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 2,4-di(propan-2-yl)-4,5-dihydro-1,3-oxazole |
| SMILES | CC(C)C1=NC(C(C)C)CO1 |
| InChI | InChI=1S/C9H17NO/c1-6(2)8-5-11-9(10-8)7(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | FSVCKELTLCGQHU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |