C32H38N2O4 — CID 134360620
2-(4,6,19-trimethyl-13-phenyl-12,18-dioxa-1,5-diazatetracyclo[17.2.2.28,11.02,7]pentacosa-2(7),3,5,8(25),9,11(24)-hexaen-3-yl)acetic acid (PubChem CID 134360620) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is 2-(4,6,19-trimethyl-13-phenyl-12,18-dioxa-1,5-diazatetracyclo[17.2.2.28,11.02,7]pentacosa-2(7),3,5,8(25),9,11(24)-hexaen-3-yl)acetic acid.
| Compound Name | 2-(4,6,19-trimethyl-13-phenyl-12,18-dioxa-1,5-diazatetracyclo[17.2.2.28,11.02,7]pentacosa-2(7),3,5,8(25),9,11(24)-hexaen-3-yl)acetic acid |
|---|---|
| PubChem CID | 134360620 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 2-(4,6,19-trimethyl-13-phenyl-12,18-dioxa-1,5-diazatetracyclo[17.2.2.28,11.02,7]pentacosa-2(7),3,5,8(25),9,11(24)-hexaen-3-yl)acetic acid |
| SMILES | Cc1nc(C)c2c(c1CC(=O)O)N1CCC(C)(CC1)OCCCCC(c1ccccc1)Oc1ccc-2cc1 |
| InChI | InChI=1S/C32H38N2O4/c1-22-27(21-29(35)36)31-30(23(2)33-22)25-12-14-26(15-13-25)38-28(24-9-5-4-6-10-24)11-7-8-20-37-32(3)16-18-34(31)19-17-32/h4-6,9-10,12-15,28H,7-8,11,16-21H2,1-3H3,(H,35,36) |
| InChIKey | YRWPMLCMTPNONB-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |