C30H32F4N2O3 — CID 138497875
2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-[4-[2-(2,3,5,6-tetrafluorophenyl)ethoxy]phenyl]-3-pyridinyl]acetic acid (PubChem CID 138497875) has the molecular formula C30H32F4N2O3 and a molecular weight of 544.59 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-[4-[2-(2,3,5,6-tetrafluorophenyl)ethoxy]phenyl]-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-[4-[2-(2,3,5,6-tetrafluorophenyl)ethoxy]phenyl]-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 138497875 |
| Molecular Formula | C30H32F4N2O3 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2,6-dimethyl-5-[4-[2-(2,3,5,6-tetrafluorophenyl)ethoxy]phenyl]-3-pyridinyl]acetic acid |
| SMILES | Cc1nc(C)c(-c2ccc(OCCc3c(F)c(F)cc(F)c3F)cc2)c(N2CCC(C)(C)CC2)c1CC(=O)O |
| InChI | InChI=1S/C30H32F4N2O3/c1-17-22(15-25(37)38)29(36-12-10-30(3,4)11-13-36)26(18(2)35-17)19-5-7-20(8-6-19)39-14-9-21-27(33)23(31)16-24(32)28(21)34/h5-8,16H,9-15H2,1-4H3,(H,37,38) |
| InChIKey | MJPJRZHGVXHMRR-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|