C33H37N3O3 — CID 142398933
2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[4-[2-(4-methylphenyl)ethoxy]phenyl]-6-prop-2-ynimidoyl-3-pyridinyl]acetic acid (PubChem CID 142398933) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[4-[2-(4-methylphenyl)ethoxy]phenyl]-6-prop-2-ynimidoyl-3-pyridinyl]acetic acid.
| Compound Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[4-[2-(4-methylphenyl)ethoxy]phenyl]-6-prop-2-ynimidoyl-3-pyridinyl]acetic acid |
|---|---|
| PubChem CID | 142398933 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 2-[4-(4,4-dimethylpiperidin-1-yl)-2-methyl-5-[4-[2-(4-methylphenyl)ethoxy]phenyl]-6-prop-2-ynimidoyl-3-pyridinyl]acetic acid |
| SMILES | [H]/N=C(\C#C)c1nc(C)c(CC(=O)O)c(N2CCC(C)(C)CC2)c1-c1ccc(OCCc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C33H37N3O3/c1-6-28(34)31-30(25-11-13-26(14-12-25)39-20-15-24-9-7-22(2)8-10-24)32(27(21-29(37)38)23(3)35-31)36-18-16-33(4,5)17-19-36/h1,7-14,34H,15-21H2,2-5H3,(H,37,38)/b34-28+ |
| InChIKey | XKERQNCKSBPTNM-CDSHQWRTSA-N |
| XLogP | 6.24 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|