C23H31NO7S2 — CID 134362349
2-methyl-2-methylsulfonyl-4-[4-[4-(5-methylsulfonyloxypent-1-ynyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butanoic acid (PubChem CID 134362349) has the molecular formula C23H31NO7S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 2-methyl-2-methylsulfonyl-4-[4-[4-(5-methylsulfonyloxypent-1-ynyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butanoic acid.
| Compound Name | 2-methyl-2-methylsulfonyl-4-[4-[4-(5-methylsulfonyloxypent-1-ynyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 134362349 |
| Molecular Formula | C23H31NO7S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 2-methyl-2-methylsulfonyl-4-[4-[4-(5-methylsulfonyloxypent-1-ynyl)phenyl]-3,6-dihydro-2H-pyridin-1-yl]butanoic acid |
| SMILES | CC(CCN1CC=C(c2ccc(C#CCCCOS(C)(=O)=O)cc2)CC1)(C(=O)O)S(C)(=O)=O |
| InChI | InChI=1S/C23H31NO7S2/c1-23(22(25)26,32(2,27)28)14-17-24-15-12-21(13-16-24)20-10-8-19(9-11-20)7-5-4-6-18-31-33(3,29)30/h8-12H,4,6,13-18H2,1-3H3,(H,25,26) |
| InChIKey | CUROOVLIYNUNLR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|