C21H23N3 — CID 19960123
N-methyl-5-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridin-2-amine (PubChem CID 19960123) has the molecular formula C21H23N3 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-methyl-5-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridin-2-amine.
| Compound Name | N-methyl-5-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridin-2-amine |
|---|---|
| PubChem CID | 19960123 |
| Molecular Formula | C21H23N3 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-methyl-5-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)but-1-ynyl]pyridin-2-amine |
| SMILES | CNc1ccc(C#CCCN2CC=C(c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C21H23N3/c1-22-21-11-10-18(17-23-21)7-5-6-14-24-15-12-20(13-16-24)19-8-3-2-4-9-19/h2-4,8-12,17H,6,13-16H2,1H3,(H,22,23) |
| InChIKey | BYSKXPNBRZMPBR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|