C20H20ClN3 — CID 67550073
6-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]but-1-ynyl]pyridin-3-amine (PubChem CID 67550073) has the molecular formula C20H20ClN3 and a molecular weight of 337.85 g/mol. Its IUPAC name is 6-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]but-1-ynyl]pyridin-3-amine.
| Compound Name | 6-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]but-1-ynyl]pyridin-3-amine |
|---|---|
| PubChem CID | 67550073 |
| Molecular Formula | C20H20ClN3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 6-[4-[4-(4-chlorophenyl)-3,6-dihydro-2H-pyridin-1-yl]but-1-ynyl]pyridin-3-amine |
| SMILES | Nc1ccc(C#CCCN2CC=C(c3ccc(Cl)cc3)CC2)nc1 |
| InChI | InChI=1S/C20H20ClN3/c21-18-6-4-16(5-7-18)17-10-13-24(14-11-17)12-2-1-3-20-9-8-19(22)15-23-20/h4-10,15H,2,11-14,22H2 |
| InChIKey | AWZPBUWFYLPYTJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|