C23H26FNO3 — CID 134362389
tert-butyl 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134362389) has the molecular formula C23H26FNO3 and a molecular weight of 383.46 g/mol. Its IUPAC name is tert-butyl 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134362389 |
| Molecular Formula | C23H26FNO3 |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | tert-butyl 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC=C(c2ccc(C#CC#CCCCO)c(F)c2)CC1 |
| InChI | InChI=1S/C23H26FNO3/c1-23(2,3)28-22(27)25-14-12-18(13-15-25)20-11-10-19(21(24)17-20)9-7-5-4-6-8-16-26/h10-12,17,26H,6,8,13-16H2,1-3H3 |
| InChIKey | WWDARRQXOLBIPO-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|