C19H18FNO3 — CID 175377150
4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 175377150) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175377150 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 4-[3-fluoro-4-(7-hydroxyhepta-1,3-diynyl)phenyl]-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | O=C(O)N1CC=C(c2ccc(C#CC#CCCCO)c(F)c2)CC1 |
| InChI | InChI=1S/C19H18FNO3/c20-18-14-17(15-9-11-21(12-10-15)19(23)24)8-7-16(18)6-4-2-1-3-5-13-22/h7-9,14,22H,3,5,10-13H2,(H,23,24) |
| InChIKey | QWLWMKWUKYKJMI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|