C22H11F4N5O — CID 134362515
6-(2,3-difluoro-4-pyridinyl)-1-(5,8-difluoroquinolin-4-yl)benzimidazole-4-carboxamide (PubChem CID 134362515) has the molecular formula C22H11F4N5O and a molecular weight of 437.36 g/mol. Its IUPAC name is 6-(2,3-difluoro-4-pyridinyl)-1-(5,8-difluoroquinolin-4-yl)benzimidazole-4-carboxamide.
| Compound Name | 6-(2,3-difluoro-4-pyridinyl)-1-(5,8-difluoroquinolin-4-yl)benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 134362515 |
| Molecular Formula | C22H11F4N5O |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 6-(2,3-difluoro-4-pyridinyl)-1-(5,8-difluoroquinolin-4-yl)benzimidazole-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccnc(F)c2F)cc2c1ncn2-c1ccnc2c(F)ccc(F)c12 |
| InChI | InChI=1S/C22H11F4N5O/c23-13-1-2-14(24)20-17(13)15(4-6-28-20)31-9-30-19-12(22(27)32)7-10(8-16(19)31)11-3-5-29-21(26)18(11)25/h1-9H,(H2,27,32) |
| InChIKey | UHHSXRNFAJBYDH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|