C15H8Cl3N3O — CID 137391089
4-chloro-8-(3,5-dichlorophenyl)-1,5-naphthyridine-3-carboxamide (PubChem CID 137391089) has the molecular formula C15H8Cl3N3O and a molecular weight of 352.61 g/mol. Its IUPAC name is 4-chloro-8-(3,5-dichlorophenyl)-1,5-naphthyridine-3-carboxamide.
| Compound Name | 4-chloro-8-(3,5-dichlorophenyl)-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 137391089 |
| Molecular Formula | C15H8Cl3N3O |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 4-chloro-8-(3,5-dichlorophenyl)-1,5-naphthyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc2c(-c3cc(Cl)cc(Cl)c3)ccnc2c1Cl |
| InChI | InChI=1S/C15H8Cl3N3O/c16-8-3-7(4-9(17)5-8)10-1-2-20-14-12(18)11(15(19)22)6-21-13(10)14/h1-6H,(H2,19,22) |
| InChIKey | VCFKGQNTBWCPFI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |