C23H21ClN4O3 — CID 134364259
methyl 1-(8-chloroquinolin-3-yl)-2-methyl-6-morpholin-4-ylbenzimidazole-4-carboxylate (PubChem CID 134364259) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is methyl 1-(8-chloroquinolin-3-yl)-2-methyl-6-morpholin-4-ylbenzimidazole-4-carboxylate.
| Compound Name | methyl 1-(8-chloroquinolin-3-yl)-2-methyl-6-morpholin-4-ylbenzimidazole-4-carboxylate |
|---|---|
| PubChem CID | 134364259 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methyl 1-(8-chloroquinolin-3-yl)-2-methyl-6-morpholin-4-ylbenzimidazole-4-carboxylate |
| SMILES | COC(=O)c1cc(N2CCOCC2)cc2c1nc(C)n2-c1cnc2c(Cl)cccc2c1 |
| InChI | InChI=1S/C23H21ClN4O3/c1-14-26-22-18(23(29)30-2)11-16(27-6-8-31-9-7-27)12-20(22)28(14)17-10-15-4-3-5-19(24)21(15)25-13-17/h3-5,10-13H,6-9H2,1-2H3 |
| InChIKey | NMNAOLXGRNITIZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |