C11H14ClNO4S — CID 134367656
(3S,4S)-4-(4-chlorophenyl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol (PubChem CID 134367656) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is (3S,4S)-4-(4-chlorophenyl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol.
| Compound Name | (3S,4S)-4-(4-chlorophenyl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 134367656 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (3S,4S)-4-(4-chlorophenyl)sulfonyl-3-(hydroxymethyl)pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@H]1CNC[C@]1(O)CO |
| InChI | InChI=1S/C11H14ClNO4S/c12-8-1-3-9(4-2-8)18(16,17)10-5-13-6-11(10,15)7-14/h1-4,10,13-15H,5-7H2/t10-,11-/m0/s1 |
| InChIKey | RVKKGWLKIQGMDH-QWRGUYRKSA-N |
| XLogP | -0.19 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |