C13H10F4N2S — CID 134368146
1-methyl-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 134368146) has the molecular formula C13H10F4N2S and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-methyl-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 1-methyl-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 134368146 |
| Molecular Formula | C13H10F4N2S |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | 1-methyl-6-(2,3,5,6-tetrafluorophenyl)-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Cc1[nH]c(=S)n2c1CC(c1c(F)c(F)cc(F)c1F)C2 |
| InChI | InChI=1S/C13H10F4N2S/c1-5-9-2-6(4-19(9)13(20)18-5)10-11(16)7(14)3-8(15)12(10)17/h3,6H,2,4H2,1H3,(H,18,20) |
| InChIKey | OOCVSAXJXLUYEU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|