C8H14N2 — CID 134372298
N'-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimidamide (PubChem CID 134372298) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 134372298 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-[(1Z,3E)-2-methylpenta-1,3-dienyl]ethanimidamide |
| SMILES | C/C=C/C(C)=C\N=C(/C)N |
| InChI | InChI=1S/C8H14N2/c1-4-5-7(2)6-10-8(3)9/h4-6H,1-3H3,(H2,9,10)/b5-4+,7-6- |
| InChIKey | SNOAXSBYTGJERS-DEQVHDEQSA-N |
| XLogP | 1.84 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|