C8H11F3N2 — CID 162560089
N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]ethanimidamide (PubChem CID 162560089) has the molecular formula C8H11F3N2 and a molecular weight of 192.18 g/mol. Its IUPAC name is N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 162560089 |
| Molecular Formula | C8H11F3N2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | N'-[(1E,3Z)-2-(trifluoromethyl)penta-1,3-dienyl]ethanimidamide |
| SMILES | C/C=C\C(=C/N=C(\C)N)C(F)(F)F |
| InChI | InChI=1S/C8H11F3N2/c1-3-4-7(8(9,10)11)5-13-6(2)12/h3-5H,1-2H3,(H2,12,13)/b4-3-,7-5+ |
| InChIKey | KTWRYALAHVPRMN-QVXLNCAUSA-N |
| XLogP | 2.39 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|