C27H22Cl2N2O2 — CID 134372561
(Z,3Z)-1-(3,5-dichlorophenyl)-3-(6-methoxynaphthalen-2-yl)-3-phenylmethoxyiminoprop-1-en-1-amine (PubChem CID 134372561) has the molecular formula C27H22Cl2N2O2 and a molecular weight of 477.39 g/mol. Its IUPAC name is (Z,3Z)-1-(3,5-dichlorophenyl)-3-(6-methoxynaphthalen-2-yl)-3-phenylmethoxyiminoprop-1-en-1-amine.
| Compound Name | (Z,3Z)-1-(3,5-dichlorophenyl)-3-(6-methoxynaphthalen-2-yl)-3-phenylmethoxyiminoprop-1-en-1-amine |
|---|---|
| PubChem CID | 134372561 |
| Molecular Formula | C27H22Cl2N2O2 |
| Molecular Weight | 477.39 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | (Z,3Z)-1-(3,5-dichlorophenyl)-3-(6-methoxynaphthalen-2-yl)-3-phenylmethoxyiminoprop-1-en-1-amine |
| SMILES | COc1ccc2cc(C(/C=C(\N)c3cc(Cl)cc(Cl)c3)=N\OCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C27H22Cl2N2O2/c1-32-25-10-9-19-11-21(8-7-20(19)14-25)27(31-33-17-18-5-3-2-4-6-18)16-26(30)22-12-23(28)15-24(29)13-22/h2-16H,17,30H2,1H3/b26-16-,31-27- |
| InChIKey | XKLUHRFLIDFKMR-XTZVHRKXSA-N |
| XLogP | 7.08 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.39 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|