C29H25NO5 — CID 155406677
2-[[(E)-3-(6-methoxynaphthalen-2-yl)but-2-enoyl]amino]-5-phenylmethoxybenzoic acid (PubChem CID 155406677) has the molecular formula C29H25NO5 and a molecular weight of 467.52 g/mol. Its IUPAC name is 2-[[(E)-3-(6-methoxynaphthalen-2-yl)but-2-enoyl]amino]-5-phenylmethoxybenzoic acid.
| Compound Name | 2-[[(E)-3-(6-methoxynaphthalen-2-yl)but-2-enoyl]amino]-5-phenylmethoxybenzoic acid |
|---|---|
| PubChem CID | 155406677 |
| Molecular Formula | C29H25NO5 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | 2-[[(E)-3-(6-methoxynaphthalen-2-yl)but-2-enoyl]amino]-5-phenylmethoxybenzoic acid |
| SMILES | COc1ccc2cc(/C(C)=C/C(=O)Nc3ccc(OCc4ccccc4)cc3C(=O)O)ccc2c1 |
| InChI | InChI=1S/C29H25NO5/c1-19(21-8-9-23-16-24(34-2)11-10-22(23)15-21)14-28(31)30-27-13-12-25(17-26(27)29(32)33)35-18-20-6-4-3-5-7-20/h3-17H,18H2,1-2H3,(H,30,31)(H,32,33)/b19-14+ |
| InChIKey | PTLOYPMJJLCVQJ-XMHGGMMESA-N |
| XLogP | 6.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|