C23H19F3N2O5 — CID 22724758
5-amino-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22724758) has the molecular formula C23H19F3N2O5 and a molecular weight of 460.41 g/mol. Its IUPAC name is 5-amino-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 5-amino-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22724758 |
| Molecular Formula | C23H19F3N2O5 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 5-amino-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C/C(=C/C(=O)Nc1ccc(N)cc1C(=O)O)c1ccc2ccccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H18N2O3.C2HF3O2/c1-13(15-7-6-14-4-2-3-5-16(14)11-15)10-20(24)23-19-9-8-17(22)12-18(19)21(25)26;3-2(4,5)1(6)7/h2-12H,22H2,1H3,(H,23,24)(H,25,26);(H,6,7)/b13-10-; |
| InChIKey | AHEVLMHHFJZSDG-ALUHPYBCSA-N |
| XLogP | 4.80 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|