C30H30F3N3O6 — CID 22724673
2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]-4-(piperidin-4-ylmethylcarbamoyl)benzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 22724673) has the molecular formula C30H30F3N3O6 and a molecular weight of 585.58 g/mol. Its IUPAC name is 2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]-4-(piperidin-4-ylmethylcarbamoyl)benzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]-4-(piperidin-4-ylmethylcarbamoyl)benzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22724673 |
| Molecular Formula | C30H30F3N3O6 |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | 2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]-4-(piperidin-4-ylmethylcarbamoyl)benzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C/C(=C/C(=O)Nc1cc(C(=O)NCC2CCNCC2)ccc1C(=O)O)c1ccc2ccccc2c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C28H29N3O4.C2HF3O2/c1-18(21-7-6-20-4-2-3-5-22(20)15-21)14-26(32)31-25-16-23(8-9-24(25)28(34)35)27(33)30-17-19-10-12-29-13-11-19;3-2(4,5)1(6)7/h2-9,14-16,19,29H,10-13,17H2,1H3,(H,30,33)(H,31,32)(H,34,35);(H,6,7)/b18-14-; |
| InChIKey | MDMMXVGYBQGLNB-NYAKATHWSA-N |
| XLogP | 4.94 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|