C30H31N3O4 — CID 70170797
methyl 4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoate (PubChem CID 70170797) has the molecular formula C30H31N3O4 and a molecular weight of 497.60 g/mol. Its IUPAC name is methyl 4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoate.
| Compound Name | methyl 4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoate |
|---|---|
| PubChem CID | 70170797 |
| Molecular Formula | C30H31N3O4 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | methyl 4-[[(3R)-1-azabicyclo[2.2.2]octan-3-yl]carbamoyl]-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N[C@H]2CN3CCC2CC3)cc1NC(=O)C=C(C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H31N3O4/c1-19(22-8-7-20-5-3-4-6-23(20)16-22)15-28(34)31-26-17-24(9-10-25(26)30(36)37-2)29(35)32-27-18-33-13-11-21(27)12-14-33/h3-10,15-17,21,27H,11-14,18H2,1-2H3,(H,31,34)(H,32,35)/t27-/m0/s1 |
| InChIKey | UCFLSOFKORLBGX-MHZLTWQESA-N |
| XLogP | 4.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|