C30H33N3O4 — CID 22724700
methyl 4-[(1-methylpiperidin-4-yl)methylcarbamoyl]-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoate (PubChem CID 22724700) has the molecular formula C30H33N3O4 and a molecular weight of 499.61 g/mol. Its IUPAC name is methyl 4-[(1-methylpiperidin-4-yl)methylcarbamoyl]-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[(1-methylpiperidin-4-yl)methylcarbamoyl]-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 22724700 |
| Molecular Formula | C30H33N3O4 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | methyl 4-[(1-methylpiperidin-4-yl)methylcarbamoyl]-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NCC2CCN(C)CC2)cc1NC(=O)/C=C(/C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C30H33N3O4/c1-20(23-9-8-22-6-4-5-7-24(22)17-23)16-28(34)32-27-18-25(10-11-26(27)30(36)37-3)29(35)31-19-21-12-14-33(2)15-13-21/h4-11,16-18,21H,12-15,19H2,1-3H3,(H,31,35)(H,32,34)/b20-16- |
| InChIKey | MIDYWVSLKKATJN-SILNSSARSA-N |
| XLogP | 4.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|