C21H16FNO3 — CID 85040490
5-fluoro-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoic acid (PubChem CID 85040490) has the molecular formula C21H16FNO3 and a molecular weight of 349.36 g/mol. Its IUPAC name is 5-fluoro-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoic acid.
| Compound Name | 5-fluoro-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoic acid |
|---|---|
| PubChem CID | 85040490 |
| Molecular Formula | C21H16FNO3 |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-fluoro-2-(3-naphthalen-2-ylbut-2-enoylamino)benzoic acid |
| SMILES | CC(=CC(=O)Nc1ccc(F)cc1C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H16FNO3/c1-13(15-7-6-14-4-2-3-5-16(14)11-15)10-20(24)23-19-9-8-17(22)12-18(19)21(25)26/h2-12H,1H3,(H,23,24)(H,25,26) |
| InChIKey | MNCFTWRHOQDFSG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|