C27H22N2O5S — CID 22724924
5-(benzenesulfonamido)-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid (PubChem CID 22724924) has the molecular formula C27H22N2O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is 5-(benzenesulfonamido)-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid.
| Compound Name | 5-(benzenesulfonamido)-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22724924 |
| Molecular Formula | C27H22N2O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 5-(benzenesulfonamido)-2-[[(Z)-3-naphthalen-2-ylbut-2-enoyl]amino]benzoic acid |
| SMILES | C/C(=C/C(=O)Nc1ccc(NS(=O)(=O)c2ccccc2)cc1C(=O)O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22N2O5S/c1-18(20-12-11-19-7-5-6-8-21(19)16-20)15-26(30)28-25-14-13-22(17-24(25)27(31)32)29-35(33,34)23-9-3-2-4-10-23/h2-17,29H,1H3,(H,28,30)(H,31,32)/b18-15- |
| InChIKey | OTVDONIVTDYRQS-SDXDJHTJSA-N |
| XLogP | 5.38 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|