C24H24FN5O5S — CID 134372617
4-[[(1R)-6-(2-diazenylethoxy)-1-methyl-1-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid (PubChem CID 134372617) has the molecular formula C24H24FN5O5S and a molecular weight of 513.55 g/mol. Its IUPAC name is 4-[[(1R)-6-(2-diazenylethoxy)-1-methyl-1-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid.
| Compound Name | 4-[[(1R)-6-(2-diazenylethoxy)-1-methyl-1-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 134372617 |
| Molecular Formula | C24H24FN5O5S |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | 4-[[(1R)-6-(2-diazenylethoxy)-1-methyl-1-[2-oxo-2-(1,3-thiazol-2-ylamino)ethyl]-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid |
| SMILES | [H]/N=N/CCOc1cc2c(cc1Oc1ccc(C(=O)O)c(F)c1)[C@@](C)(CC(=O)Nc1nccs1)NCC2 |
| InChI | InChI=1S/C24H24FN5O5S/c1-24(13-21(31)30-23-27-7-9-36-23)17-12-20(35-15-2-3-16(22(32)33)18(25)11-15)19(34-8-6-29-26)10-14(17)4-5-28-24/h2-3,7,9-12,26,28H,4-6,8,13H2,1H3,(H,32,33)(H,27,30,31)/b29-26+/t24-/m1/s1 |
| InChIKey | UHRHPFWFQGHPGT-WCWATDFMSA-N |
| XLogP | 4.57 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|