C24H25FN6O5S — CID 134372632
4-[[(1R)-6-(2-azidoethoxy)-1-[2-hydroxy-2-(1,3-thiazol-2-ylamino)ethyl]-1-methyl-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid (PubChem CID 134372632) has the molecular formula C24H25FN6O5S and a molecular weight of 528.57 g/mol. Its IUPAC name is 4-[[(1R)-6-(2-azidoethoxy)-1-[2-hydroxy-2-(1,3-thiazol-2-ylamino)ethyl]-1-methyl-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid.
| Compound Name | 4-[[(1R)-6-(2-azidoethoxy)-1-[2-hydroxy-2-(1,3-thiazol-2-ylamino)ethyl]-1-methyl-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 134372632 |
| Molecular Formula | C24H25FN6O5S |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | 4-[[(1R)-6-(2-azidoethoxy)-1-[2-hydroxy-2-(1,3-thiazol-2-ylamino)ethyl]-1-methyl-3,4-dihydro-2H-isoquinolin-7-yl]oxy]-2-fluorobenzoic acid |
| SMILES | C[C@]1(CC(O)Nc2nccs2)NCCc2cc(OCCN=[N+]=[N-])c(Oc3ccc(C(=O)O)c(F)c3)cc21 |
| InChI | InChI=1S/C24H25FN6O5S/c1-24(13-21(32)30-23-27-7-9-37-23)17-12-20(36-15-2-3-16(22(33)34)18(25)11-15)19(35-8-6-29-31-26)10-14(17)4-5-28-24/h2-3,7,9-12,21,28,32H,4-6,8,13H2,1H3,(H,27,30)(H,33,34)/t21?,24-/m1/s1 |
| InChIKey | GZPBCOORDPKPPY-MQNHUJCZSA-N |
| XLogP | 4.64 |
| TPSA | 161.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|