C12H24FN — CID 134373431
4-(2,3-dimethylbutyl)-4-fluoro-1-methylpiperidine (PubChem CID 134373431) has the molecular formula C12H24FN and a molecular weight of 201.33 g/mol. Its IUPAC name is 4-(2,3-dimethylbutyl)-4-fluoro-1-methylpiperidine.
| Compound Name | 4-(2,3-dimethylbutyl)-4-fluoro-1-methylpiperidine |
|---|---|
| PubChem CID | 134373431 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | 4-(2,3-dimethylbutyl)-4-fluoro-1-methylpiperidine |
| SMILES | CC(C)C(C)CC1(F)CCN(C)CC1 |
| InChI | InChI=1S/C12H24FN/c1-10(2)11(3)9-12(13)5-7-14(4)8-6-12/h10-11H,5-9H2,1-4H3 |
| InChIKey | SONFKJYQFYMNSW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |