C13H13ClF2N2O — CID 134373783
(5-chloro-1H-indazol-7-yl)-[1-(difluoromethyl)cyclobutyl]methanol (PubChem CID 134373783) has the molecular formula C13H13ClF2N2O and a molecular weight of 286.71 g/mol. Its IUPAC name is (5-chloro-1H-indazol-7-yl)-[1-(difluoromethyl)cyclobutyl]methanol.
| Compound Name | (5-chloro-1H-indazol-7-yl)-[1-(difluoromethyl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 134373783 |
| Molecular Formula | C13H13ClF2N2O |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (5-chloro-1H-indazol-7-yl)-[1-(difluoromethyl)cyclobutyl]methanol |
| SMILES | OC(c1cc(Cl)cc2cn[nH]c12)C1(C(F)F)CCC1 |
| InChI | InChI=1S/C13H13ClF2N2O/c14-8-4-7-6-17-18-10(7)9(5-8)11(19)13(12(15)16)2-1-3-13/h4-6,11-12,19H,1-3H2,(H,17,18) |
| InChIKey | ZJPDAXWTZBQMEO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |