C18H23FN2O4S — CID 134373981
4-[[3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 134373981) has the molecular formula C18H23FN2O4S and a molecular weight of 382.46 g/mol. Its IUPAC name is 4-[[3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134373981 |
| Molecular Formula | C18H23FN2O4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 4-[[3-(4-fluorophenyl)sulfinylpyrrolidine-1-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)N2CCC(S(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C18H23FN2O4S/c19-13-3-7-15(8-4-13)26(25)16-9-10-21(11-16)18(24)20-14-5-1-12(2-6-14)17(22)23/h3-4,7-8,12,14,16H,1-2,5-6,9-11H2,(H,20,24)(H,22,23) |
| InChIKey | OQZGRZBORNOMQB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |