C14H12ClFN2S — CID 134374213
(4S)-4-(5-chloro-2-fluorophenyl)-9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (PubChem CID 134374213) has the molecular formula C14H12ClFN2S and a molecular weight of 294.78 g/mol. Its IUPAC name is (4S)-4-(5-chloro-2-fluorophenyl)-9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
| Compound Name | (4S)-4-(5-chloro-2-fluorophenyl)-9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
|---|---|
| PubChem CID | 134374213 |
| Molecular Formula | C14H12ClFN2S |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | (4S)-4-(5-chloro-2-fluorophenyl)-9-methyl-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| SMILES | Cc1[nH]c(=S)n2c1C1C[C@]1(c1cc(Cl)ccc1F)C2 |
| InChI | InChI=1S/C14H12ClFN2S/c1-7-12-10-5-14(10,6-18(12)13(19)17-7)9-4-8(15)2-3-11(9)16/h2-4,10H,5-6H2,1H3,(H,17,19)/t10?,14-/m1/s1 |
| InChIKey | HILSAVJVVUFILV-LNUXAPHWSA-N |
| XLogP | 4.09 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|