C19H21BrFN3S — CID 138680554
(2R,4S)-4-(5-bromo-2-fluorophenyl)-9-[2-(cyclopropylmethylamino)ethyl]-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione (PubChem CID 138680554) has the molecular formula C19H21BrFN3S and a molecular weight of 422.37 g/mol. Its IUPAC name is (2R,4S)-4-(5-bromo-2-fluorophenyl)-9-[2-(cyclopropylmethylamino)ethyl]-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione.
| Compound Name | (2R,4S)-4-(5-bromo-2-fluorophenyl)-9-[2-(cyclopropylmethylamino)ethyl]-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
|---|---|
| PubChem CID | 138680554 |
| Molecular Formula | C19H21BrFN3S |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (2R,4S)-4-(5-bromo-2-fluorophenyl)-9-[2-(cyclopropylmethylamino)ethyl]-6,8-diazatricyclo[4.3.0.02,4]non-1(9)-ene-7-thione |
| SMILES | Fc1ccc(Br)cc1[C@]12C[C@H]1c1c(CCNCC3CC3)[nH]c(=S)n1C2 |
| InChI | InChI=1S/C19H21BrFN3S/c20-12-3-4-15(21)13(7-12)19-8-14(19)17-16(23-18(25)24(17)10-19)5-6-22-9-11-1-2-11/h3-4,7,11,14,22H,1-2,5-6,8-10H2,(H,23,25)/t14-,19+/m0/s1 |
| InChIKey | WRQQCGNFRMYKOI-IFXJQAMLSA-N |
| XLogP | 4.43 |
| TPSA | 32.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|