C8H12N2S — CID 134374223
1,7-dimethyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 134374223) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 1,7-dimethyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 1,7-dimethyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 134374223 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 1,7-dimethyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | Cc1[nH]c(=S)n2c1C(C)CC2 |
| InChI | InChI=1S/C8H12N2S/c1-5-3-4-10-7(5)6(2)9-8(10)11/h5H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | SDYQGKATXUZNBC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|