C12H20N2S — CID 134376953
6-cyclohexyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3-thiol (PubChem CID 134376953) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 6-cyclohexyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3-thiol.
| Compound Name | 6-cyclohexyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3-thiol |
|---|---|
| PubChem CID | 134376953 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 6-cyclohexyl-3,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]imidazole-3-thiol |
| SMILES | SC1NC=C2CC(C3CCCCC3)CN21 |
| InChI | InChI=1S/C12H20N2S/c15-12-13-7-11-6-10(8-14(11)12)9-4-2-1-3-5-9/h7,9-10,12-13,15H,1-6,8H2 |
| InChIKey | PWHLYIOTXUEPBC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|