C12H18N2S — CID 134368074
6-cyclohexyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione (PubChem CID 134368074) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 6-cyclohexyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione.
| Compound Name | 6-cyclohexyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
|---|---|
| PubChem CID | 134368074 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 6-cyclohexyl-2,5,6,7-tetrahydropyrrolo[1,2-c]imidazole-3-thione |
| SMILES | S=c1[nH]cc2n1CC(C1CCCCC1)C2 |
| InChI | InChI=1S/C12H18N2S/c15-12-13-7-11-6-10(8-14(11)12)9-4-2-1-3-5-9/h7,9-10H,1-6,8H2,(H,13,15) |
| InChIKey | URJCPWWAKQFTRX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|