C13H24N2S — CID 143389054
4-(3-propylheptan-2-yl)-1,3-dihydroimidazole-2-thione (PubChem CID 143389054) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 4-(3-propylheptan-2-yl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(3-propylheptan-2-yl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 143389054 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-(3-propylheptan-2-yl)-1,3-dihydroimidazole-2-thione |
| SMILES | CCCCC(CCC)C(C)c1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C13H24N2S/c1-4-6-8-11(7-5-2)10(3)12-9-14-13(16)15-12/h9-11H,4-8H2,1-3H3,(H2,14,15,16) |
| InChIKey | XJPUMQSNJKCKKG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|