C12H20N2S — CID 15712812
4-(3-cyclohexylpropyl)-1,3-dihydroimidazole-2-thione (PubChem CID 15712812) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 4-(3-cyclohexylpropyl)-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-(3-cyclohexylpropyl)-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 15712812 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-(3-cyclohexylpropyl)-1,3-dihydroimidazole-2-thione |
| SMILES | S=c1[nH]cc(CCCC2CCCCC2)[nH]1 |
| InChI | InChI=1S/C12H20N2S/c15-12-13-9-11(14-12)8-4-7-10-5-2-1-3-6-10/h9-10H,1-8H2,(H2,13,14,15) |
| InChIKey | OMSXYKDJLIRNFX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|