C11H16N2S — CID 11637074
4-[(3-ethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 11637074) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 4-[(3-ethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(3-ethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 11637074 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 4-[(3-ethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | CCC1=CC(Cc2c[nH]c(=S)[nH]2)CC1 |
| InChI | InChI=1S/C11H16N2S/c1-2-8-3-4-9(5-8)6-10-7-12-11(14)13-10/h5,7,9H,2-4,6H2,1H3,(H2,12,13,14) |
| InChIKey | PNMFZNXLDZSULU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|