C15H18F2N2S — CID 143208224
4-[[(1S)-2-[(2E,4E)-1,5-difluorohexa-2,4-dien-3-yl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 143208224) has the molecular formula C15H18F2N2S and a molecular weight of 296.39 g/mol. Its IUPAC name is 4-[[(1S)-2-[(2E,4E)-1,5-difluorohexa-2,4-dien-3-yl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[[(1S)-2-[(2E,4E)-1,5-difluorohexa-2,4-dien-3-yl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 143208224 |
| Molecular Formula | C15H18F2N2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-[[(1S)-2-[(2E,4E)-1,5-difluorohexa-2,4-dien-3-yl]cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C/C(F)=C\C(=C/CF)C1=CCC[C@H]1Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C15H18F2N2S/c1-10(17)7-12(5-6-16)14-4-2-3-11(14)8-13-9-18-15(20)19-13/h4-5,7,9,11H,2-3,6,8H2,1H3,(H2,18,19,20)/b10-7+,12-5+/t11-/m0/s1 |
| InChIKey | RYSLCXVAJNMKOS-KJHNLPEPSA-N |
| XLogP | 4.72 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|