C18H25FN2S — CID 142833275
4-[[2-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-3-propan-2-ylcyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 142833275) has the molecular formula C18H25FN2S and a molecular weight of 320.48 g/mol. Its IUPAC name is 4-[[2-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-3-propan-2-ylcyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[[2-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-3-propan-2-ylcyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 142833275 |
| Molecular Formula | C18H25FN2S |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-[[2-[(2E,4Z)-6-fluorohexa-2,4-dien-3-yl]-3-propan-2-ylcyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C/C=C(\C=C/CF)C1=C(C(C)C)CCC1Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C18H25FN2S/c1-4-13(6-5-9-19)17-14(7-8-16(17)12(2)3)10-15-11-20-18(22)21-15/h4-6,11-12,14H,7-10H2,1-3H3,(H2,20,21,22)/b6-5-,13-4+ |
| InChIKey | PDJKTQFEZGZHRC-BDNXDWBHSA-N |
| XLogP | 5.45 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|