C15H17FN2S — CID 143208303
4-[[2-(3-fluorocyclohexa-1,5-dien-1-yl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione (PubChem CID 143208303) has the molecular formula C15H17FN2S and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[[2-(3-fluorocyclohexa-1,5-dien-1-yl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[[2-(3-fluorocyclohexa-1,5-dien-1-yl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 143208303 |
| Molecular Formula | C15H17FN2S |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[[2-(3-fluorocyclohexa-1,5-dien-1-yl)cyclopent-2-en-1-yl]methyl]-1,3-dihydroimidazole-2-thione |
| SMILES | FC1C=C(C2=CCCC2Cc2c[nH]c(=S)[nH]2)C=CC1 |
| InChI | InChI=1S/C15H17FN2S/c16-12-5-1-3-10(7-12)14-6-2-4-11(14)8-13-9-17-15(19)18-13/h1,3,6-7,9,11-12H,2,4-5,8H2,(H2,17,18,19) |
| InChIKey | YDRNFTWLLADVDS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|