C14H21FN2S — CID 142833272
4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione (PubChem CID 142833272) has the molecular formula C14H21FN2S and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 142833272 |
| Molecular Formula | C14H21FN2S |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C/C(=C\CCCCc1c[nH]c(=S)[nH]1)C/C=C\CF |
| InChI | InChI=1S/C14H21FN2S/c1-12(8-5-6-10-15)7-3-2-4-9-13-11-16-14(18)17-13/h5-7,11H,2-4,8-10H2,1H3,(H2,16,17,18)/b6-5-,12-7+ |
| InChIKey | ICJMURRIODIOPL-UNKATYBDSA-N |
| XLogP | 4.65 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|