C17H30N2S — CID 142833292
but-1-ene;4-[(2,3-dimethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione;ethane (PubChem CID 142833292) has the molecular formula C17H30N2S and a molecular weight of 294.51 g/mol. Its IUPAC name is but-1-ene;4-[(2,3-dimethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione;ethane.
| Compound Name | but-1-ene;4-[(2,3-dimethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione;ethane |
|---|---|
| PubChem CID | 142833292 |
| Molecular Formula | C17H30N2S |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | but-1-ene;4-[(2,3-dimethylcyclopent-2-en-1-yl)methyl]-1,3-dihydroimidazole-2-thione;ethane |
| SMILES | C=CCC.CC.CC1=C(C)C(Cc2c[nH]c(=S)[nH]2)CC1 |
| InChI | InChI=1S/C11H16N2S.C4H8.C2H6/c1-7-3-4-9(8(7)2)5-10-6-12-11(14)13-10;1-3-4-2;1-2/h6,9H,3-5H2,1-2H3,(H2,12,13,14);3H,1,4H2,2H3;1-2H3 |
| InChIKey | MYCAWUZXOBCYME-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|