C18H28F2N2S — CID 142833271
2-fluorobut-1-ene;4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione (PubChem CID 142833271) has the molecular formula C18H28F2N2S and a molecular weight of 342.50 g/mol. Its IUPAC name is 2-fluorobut-1-ene;4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione.
| Compound Name | 2-fluorobut-1-ene;4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 142833271 |
| Molecular Formula | C18H28F2N2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-fluorobut-1-ene;4-[(5E,8Z)-10-fluoro-6-methyldeca-5,8-dienyl]-1,3-dihydroimidazole-2-thione |
| SMILES | C/C(=C\CCCCc1c[nH]c(=S)[nH]1)C/C=C\CF.C=C(F)CC |
| InChI | InChI=1S/C14H21FN2S.C4H7F/c1-12(8-5-6-10-15)7-3-2-4-9-13-11-16-14(18)17-13;1-3-4(2)5/h5-7,11H,2-4,8-10H2,1H3,(H2,16,17,18);2-3H2,1H3/b6-5-,12-7+; |
| InChIKey | DQGXFMSDNSQZJB-ZFZRLXPFSA-N |
| XLogP | 6.53 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|